C7H8F2N2OS — CID 130678430
2-(difluoromethyl)-5-(thiolan-3-yl)-1,3,4-oxadiazole (PubChem CID 130678430) has the molecular formula C7H8F2N2OS and a molecular weight of 206.22 g/mol. Its IUPAC name is 2-(difluoromethyl)-5-(thiolan-3-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(difluoromethyl)-5-(thiolan-3-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 130678430 |
| Molecular Formula | C7H8F2N2OS |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 2-(difluoromethyl)-5-(thiolan-3-yl)-1,3,4-oxadiazole |
| SMILES | FC(F)c1nnc(C2CCSC2)o1 |
| InChI | InChI=1S/C7H8F2N2OS/c8-5(9)7-11-10-6(12-7)4-1-2-13-3-4/h4-5H,1-3H2 |
| InChIKey | XNJKNEDNUHFOJR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |