C23H28F3N2O2S+ — CID 143348406
ethoxy-[2-methyl-4-[(1R)-1-[[2-methyl-2-[4-(trifluoromethylsulfanyl)phenyl]cyclopropanecarbonyl]amino]ethyl]phenyl]azanium (PubChem CID 143348406) has the molecular formula C23H28F3N2O2S+ and a molecular weight of 453.55 g/mol. Its IUPAC name is ethoxy-[2-methyl-4-[(1R)-1-[[2-methyl-2-[4-(trifluoromethylsulfanyl)phenyl]cyclopropanecarbonyl]amino]ethyl]phenyl]azanium.
| Compound Name | ethoxy-[2-methyl-4-[(1R)-1-[[2-methyl-2-[4-(trifluoromethylsulfanyl)phenyl]cyclopropanecarbonyl]amino]ethyl]phenyl]azanium |
|---|---|
| PubChem CID | 143348406 |
| Molecular Formula | C23H28F3N2O2S+ |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | ethoxy-[2-methyl-4-[(1R)-1-[[2-methyl-2-[4-(trifluoromethylsulfanyl)phenyl]cyclopropanecarbonyl]amino]ethyl]phenyl]azanium |
| SMILES | CCO[NH2+]c1ccc([C@@H](C)NC(=O)C2CC2(C)c2ccc(SC(F)(F)F)cc2)cc1C |
| InChI | InChI=1S/C23H27F3N2O2S/c1-5-30-28-20-11-6-16(12-14(20)2)15(3)27-21(29)19-13-22(19,4)17-7-9-18(10-8-17)31-23(24,25)26/h6-12,15,19,28H,5,13H2,1-4H3,(H,27,29)/p+1/t15-,19?,22?/m1/s1 |
| InChIKey | SKNOEBCVGZFCDH-DMXYAQSFSA-O |
| XLogP | 4.91 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|