C22H23F3N2O5S — CID 88965237
aminosulfanyl 2-(hydroxymethyl)-4-[(1R)-1-[[(1R,2R)-2-methyl-2-[4-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]ethyl]benzoate (PubChem CID 88965237) has the molecular formula C22H23F3N2O5S and a molecular weight of 484.50 g/mol. Its IUPAC name is aminosulfanyl 2-(hydroxymethyl)-4-[(1R)-1-[[(1R,2R)-2-methyl-2-[4-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]ethyl]benzoate.
| Compound Name | aminosulfanyl 2-(hydroxymethyl)-4-[(1R)-1-[[(1R,2R)-2-methyl-2-[4-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]ethyl]benzoate |
|---|---|
| PubChem CID | 88965237 |
| Molecular Formula | C22H23F3N2O5S |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | aminosulfanyl 2-(hydroxymethyl)-4-[(1R)-1-[[(1R,2R)-2-methyl-2-[4-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]ethyl]benzoate |
| SMILES | C[C@@H](NC(=O)[C@@H]1C[C@@]1(C)c1ccc(OC(F)(F)F)cc1)c1ccc(C(=O)OSN)c(CO)c1 |
| InChI | InChI=1S/C22H23F3N2O5S/c1-12(13-3-8-17(14(9-13)11-28)20(30)32-33-26)27-19(29)18-10-21(18,2)15-4-6-16(7-5-15)31-22(23,24)25/h3-9,12,18,28H,10-11,26H2,1-2H3,(H,27,29)/t12-,18+,21+/m1/s1 |
| InChIKey | UWMOXFPNFVKKSP-NWXLUKJOSA-N |
| XLogP | 3.91 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|