C18H31NO — CID 143349256
But-2-ene;1-[2-(5-methylcyclohexa-1,5-dien-1-yl)oxyethyl]piperidine (PubChem CID 143349256) has the molecular formula C18H31NO and a molecular weight of 277.40 g/mol. Its IUPAC name is but-2-ene;1-[2-(5-methylcyclohexa-1,5-dien-1-yl)oxyethyl]piperidine.
| Compound Name | But-2-ene;1-[2-(5-methylcyclohexa-1,5-dien-1-yl)oxyethyl]piperidine |
|---|---|
| PubChem CID | 143349256 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | but-2-ene;1-[2-(5-methylcyclohexa-1,5-dien-1-yl)oxyethyl]piperidine |
| SMILES | CC=CC.CC1=CC(=CCC1)OCCN2CCCCC2 |
| InChI | InChI=1S/C14H23NO.C4H8/c1-13-6-5-7-14(12-13)16-11-10-15-8-3-2-4-9-15;1-3-4-2/h7,12H,2-6,8-11H2,1H3;3-4H,1-2H3 |
| InChIKey | NQXGXWUUPTWHFX-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | 290 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|