C9H11NO — CID 143349265
(3Z,5Z)-7-hydroxy-4-methyl-2-methylidenehepta-3,5-dienenitrile (PubChem CID 143349265) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is (3Z,5Z)-7-hydroxy-4-methyl-2-methylidenehepta-3,5-dienenitrile.
| Compound Name | (3Z,5Z)-7-hydroxy-4-methyl-2-methylidenehepta-3,5-dienenitrile |
|---|---|
| PubChem CID | 143349265 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | (3Z,5Z)-7-hydroxy-4-methyl-2-methylidenehepta-3,5-dienenitrile |
| SMILES | C=C(C#N)/C=C(C)\C=C/CO |
| InChI | InChI=1S/C9H11NO/c1-8(4-3-5-11)6-9(2)7-10/h3-4,6,11H,2,5H2,1H3/b4-3-,8-6- |
| InChIKey | CLGXMQQUYKWLAT-XYMCEGRYSA-N |
| XLogP | 1.56 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|