C26H33N5O5 — CID 143350695
(3S,3aS,6aR)-2-[(2S)-2-(carbamoylamino)-2-(2,3-dihydro-1H-inden-2-yl)acetyl]-N-[2,3-dioxo-3-(prop-2-enylamino)propyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 143350695) has the molecular formula C26H33N5O5 and a molecular weight of 495.58 g/mol. Its IUPAC name is (3S,3aS,6aR)-2-[(2S)-2-(carbamoylamino)-2-(2,3-dihydro-1H-inden-2-yl)acetyl]-N-[2,3-dioxo-3-(prop-2-enylamino)propyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | (3S,3aS,6aR)-2-[(2S)-2-(carbamoylamino)-2-(2,3-dihydro-1H-inden-2-yl)acetyl]-N-[2,3-dioxo-3-(prop-2-enylamino)propyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 143350695 |
| Molecular Formula | C26H33N5O5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | (3S,3aS,6aR)-2-[(2S)-2-(carbamoylamino)-2-(2,3-dihydro-1H-inden-2-yl)acetyl]-N-[2,3-dioxo-3-(prop-2-enylamino)propyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | C=CCNC(=O)C(=O)CNC(=O)[C@@H]1[C@H]2CCC[C@H]2CN1C(=O)[C@@H](NC(N)=O)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C26H33N5O5/c1-2-10-28-23(33)20(32)13-29-24(34)22-19-9-5-8-17(19)14-31(22)25(35)21(30-26(27)36)18-11-15-6-3-4-7-16(15)12-18/h2-4,6-7,17-19,21-22H,1,5,8-14H2,(H,28,33)(H,29,34)(H3,27,30,36)/t17-,19-,21-,22-/m0/s1 |
| InChIKey | TUBSAVGFIXFHGJ-UDDWMFPDSA-N |
| XLogP | 0.05 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|