C27H39N5O5 — CID 143351905
(3S,3aS,6aR)-2-[(2S)-2-(carbamoylamino)-2-cyclohexylacetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 143351905) has the molecular formula C27H39N5O5 and a molecular weight of 513.64 g/mol. Its IUPAC name is (3S,3aS,6aR)-2-[(2S)-2-(carbamoylamino)-2-cyclohexylacetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | (3S,3aS,6aR)-2-[(2S)-2-(carbamoylamino)-2-cyclohexylacetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 143351905 |
| Molecular Formula | C27H39N5O5 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | (3S,3aS,6aR)-2-[(2S)-2-(carbamoylamino)-2-cyclohexylacetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | C#CCCC(NC(=O)[C@@H]1[C@H]2CCC[C@H]2CN1C(=O)[C@@H](NC(N)=O)C1CCCCC1)C(=O)C(=O)NCC=C |
| InChI | InChI=1S/C27H39N5O5/c1-3-5-14-20(23(33)25(35)29-15-4-2)30-24(34)22-19-13-9-12-18(19)16-32(22)26(36)21(31-27(28)37)17-10-7-6-8-11-17/h1,4,17-22H,2,5-16H2,(H,29,35)(H,30,34)(H3,28,31,37)/t18-,19-,20?,21-,22-/m0/s1 |
| InChIKey | IUPAVUQDXWITNJ-FUCPVKEDSA-N |
| XLogP | 1.00 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|