C19H28N4O4 — CID 143353459
3-[[1-[2-cyclohexyl-2-(methylamino)acetyl]pyrrolidine-2-carbonyl]amino]-2-oxobutanoyl cyanide (PubChem CID 143353459) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-[[1-[2-cyclohexyl-2-(methylamino)acetyl]pyrrolidine-2-carbonyl]amino]-2-oxobutanoyl cyanide.
| Compound Name | 3-[[1-[2-cyclohexyl-2-(methylamino)acetyl]pyrrolidine-2-carbonyl]amino]-2-oxobutanoyl cyanide |
|---|---|
| PubChem CID | 143353459 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 3-[[1-[2-cyclohexyl-2-(methylamino)acetyl]pyrrolidine-2-carbonyl]amino]-2-oxobutanoyl cyanide |
| SMILES | CNC(C(=O)N1CCCC1C(=O)NC(C)C(=O)C(=O)C#N)C1CCCCC1 |
| InChI | InChI=1S/C19H28N4O4/c1-12(17(25)15(24)11-20)22-18(26)14-9-6-10-23(14)19(27)16(21-2)13-7-4-3-5-8-13/h12-14,16,21H,3-10H2,1-2H3,(H,22,26) |
| InChIKey | UWHHRBCUSKAKTL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 119.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|