About 4-methyl-2,3,4,5-tetrahydro-1λ6-benzothiepine 1,1-dioxide
4-methyl-2,3,4,5-tetrahydro-1λ6-benzothiepine 1,1-dioxide (PubChem CID 143356879) has the molecular formula C11H14O2S
and a molecular weight of 210.30 g/mol. Its IUPAC name is 4-methyl-2,3,4,5-tetrahydro-1λ6-benzothiepine 1,1-dioxide.
Analyze 4-methyl-2,3,4,5-tetrahydro-1λ6-benzothiepine 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,3,4,5-tetrahydro-1λ6-benzothiepine 1,1-dioxide?
The IUPAC name of 4-methyl-2,3,4,5-tetrahydro-1λ6-benzothiepine 1,1-dioxide (CID 143356879) is 4-methyl-2,3,4,5-tetrahydro-1λ6-benzothiepine 1,1-dioxide.
What is the SMILES notation for 4-methyl-2,3,4,5-tetrahydro-1λ6-benzothiepine 1,1-dioxide?
The canonical SMILES for 4-methyl-2,3,4,5-tetrahydro-1λ6-benzothiepine 1,1-dioxide is CC1CCS(=O)(=O)c2ccccc2C1.
What is the InChIKey of 4-methyl-2,3,4,5-tetrahydro-1λ6-benzothiepine 1,1-dioxide?
The InChIKey is LPPFKHLQEFKHCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2S/c1-9-6-7-14(12,13)11-5-3-2-4-10(11)8-9/h2-5,9H,6-8H2,1H3.
What are the key properties of 4-methyl-2,3,4,5-tetrahydro-1λ6-benzothiepine 1,1-dioxide?
4-methyl-2,3,4,5-tetrahydro-1λ6-benzothiepine 1,1-dioxide has a molecular weight of 210.30 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,3,4,5-tetrahydro-1λ6-benzothiepine 1,1-dioxide is sourced from PubChem (CID 143356879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).