C25H44N4O4 — CID 143359670
N-[5-[(1-cyclobutyl-3,4-dioxobutan-2-yl)amino]-4-methylhex-5-enyl]-N,4,4-trimethyl-3-(methylcarbamoylamino)pentanamide (PubChem CID 143359670) has the molecular formula C25H44N4O4 and a molecular weight of 464.65 g/mol. Its IUPAC name is N-[5-[(1-cyclobutyl-3,4-dioxobutan-2-yl)amino]-4-methylhex-5-enyl]-N,4,4-trimethyl-3-(methylcarbamoylamino)pentanamide.
| Compound Name | N-[5-[(1-cyclobutyl-3,4-dioxobutan-2-yl)amino]-4-methylhex-5-enyl]-N,4,4-trimethyl-3-(methylcarbamoylamino)pentanamide |
|---|---|
| PubChem CID | 143359670 |
| Molecular Formula | C25H44N4O4 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.34 |
| IUPAC Name | N-[5-[(1-cyclobutyl-3,4-dioxobutan-2-yl)amino]-4-methylhex-5-enyl]-N,4,4-trimethyl-3-(methylcarbamoylamino)pentanamide |
| SMILES | C=C(NC(CC1CCC1)C(=O)C=O)C(C)CCCN(C)C(=O)CC(NC(=O)NC)C(C)(C)C |
| InChI | InChI=1S/C25H44N4O4/c1-17(18(2)27-20(21(31)16-30)14-19-11-8-12-19)10-9-13-29(7)23(32)15-22(25(3,4)5)28-24(33)26-6/h16-17,19-20,22,27H,2,8-15H2,1,3-7H3,(H2,26,28,33) |
| InChIKey | CSACDSVXZCCSBC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|