C16H21N3O2S — CID 143363287
ethane;methanol;4-(7-methoxyquinolin-2-yl)-1,3-thiazol-2-amine (PubChem CID 143363287) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is ethane;methanol;4-(7-methoxyquinolin-2-yl)-1,3-thiazol-2-amine.
| Compound Name | ethane;methanol;4-(7-methoxyquinolin-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 143363287 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | ethane;methanol;4-(7-methoxyquinolin-2-yl)-1,3-thiazol-2-amine |
| SMILES | CC.CO.COc1ccc2ccc(-c3csc(N)n3)nc2c1 |
| InChI | InChI=1S/C13H11N3OS.C2H6.CH4O/c1-17-9-4-2-8-3-5-10(15-11(8)6-9)12-7-18-13(14)16-12;2*1-2/h2-7H,1H3,(H2,14,16);1-2H3;2H,1H3 |
| InChIKey | VADUSDYDSMEECK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |