C12H18N3O2P — CID 143363616
(E)-1-(2,6-dimethoxyphenyl)-N'-methyl-N'-(methylideneamino)-2-phosphanylethene-1,2-diamine (PubChem CID 143363616) has the molecular formula C12H18N3O2P and a molecular weight of 267.27 g/mol. Its IUPAC name is (E)-1-(2,6-dimethoxyphenyl)-N'-methyl-N'-(methylideneamino)-2-phosphanylethene-1,2-diamine.
| Compound Name | (E)-1-(2,6-dimethoxyphenyl)-N'-methyl-N'-(methylideneamino)-2-phosphanylethene-1,2-diamine |
|---|---|
| PubChem CID | 143363616 |
| Molecular Formula | C12H18N3O2P |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | (E)-1-(2,6-dimethoxyphenyl)-N'-methyl-N'-(methylideneamino)-2-phosphanylethene-1,2-diamine |
| SMILES | C=NN(C)/C(P)=C(\N)c1c(OC)cccc1OC |
| InChI | InChI=1S/C12H18N3O2P/c1-14-15(2)12(18)11(13)10-8(16-3)6-5-7-9(10)17-4/h5-7H,1,13,18H2,2-4H3/b12-11+ |
| InChIKey | WZJZLPGXHIDAOX-VAWYXSNFSA-N |
| XLogP | 1.71 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|