C16H22NNaO4 — CID 143363746
sodium;(E)-4-[4-(dimethylamino)phenyl]-3-methoxycarbonylbut-3-enoate;ethane (PubChem CID 143363746) has the molecular formula C16H22NNaO4 and a molecular weight of 315.35 g/mol. Its IUPAC name is sodium;(E)-4-[4-(dimethylamino)phenyl]-3-methoxycarbonylbut-3-enoate;ethane.
| Compound Name | sodium;(E)-4-[4-(dimethylamino)phenyl]-3-methoxycarbonylbut-3-enoate;ethane |
|---|---|
| PubChem CID | 143363746 |
| Molecular Formula | C16H22NNaO4 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | sodium;(E)-4-[4-(dimethylamino)phenyl]-3-methoxycarbonylbut-3-enoate;ethane |
| SMILES | CC.COC(=O)/C(=C/c1ccc(N(C)C)cc1)CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C14H17NO4.C2H6.Na/c1-15(2)12-6-4-10(5-7-12)8-11(9-13(16)17)14(18)19-3;1-2;/h4-8H,9H2,1-3H3,(H,16,17);1-2H3;/q;;+1/p-1/b11-8+;; |
| InChIKey | PWKNGZPPUHQDJM-OHENRDTHSA-M |
| XLogP | -1.52 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|