About 4-methyl-4,5-dihydro-1H-1,3-diazepine-5,6,7-triamine
4-methyl-4,5-dihydro-1H-1,3-diazepine-5,6,7-triamine (PubChem CID 143364724) has the molecular formula C6H13N5
and a molecular weight of 155.20 g/mol. Its IUPAC name is 4-methyl-4,5-dihydro-1H-1,3-diazepine-5,6,7-triamine.
Analyze 4-methyl-4,5-dihydro-1H-1,3-diazepine-5,6,7-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-4,5-dihydro-1H-1,3-diazepine-5,6,7-triamine?
The IUPAC name of 4-methyl-4,5-dihydro-1H-1,3-diazepine-5,6,7-triamine (CID 143364724) is 4-methyl-4,5-dihydro-1H-1,3-diazepine-5,6,7-triamine.
What is the SMILES notation for 4-methyl-4,5-dihydro-1H-1,3-diazepine-5,6,7-triamine?
The canonical SMILES for 4-methyl-4,5-dihydro-1H-1,3-diazepine-5,6,7-triamine is CC1N=CNC(N)=C(N)C1N.
What is the InChIKey of 4-methyl-4,5-dihydro-1H-1,3-diazepine-5,6,7-triamine?
The InChIKey is HMAHJVFJVRFFHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N5/c1-3-4(7)5(8)6(9)11-2-10-3/h2-4H,7-9H2,1H3,(H,10,11).
What are the key properties of 4-methyl-4,5-dihydro-1H-1,3-diazepine-5,6,7-triamine?
4-methyl-4,5-dihydro-1H-1,3-diazepine-5,6,7-triamine has a molecular weight of 155.20 g/mol, XLogP of -1.58, 0 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-4,5-dihydro-1H-1,3-diazepine-5,6,7-triamine is sourced from PubChem (CID 143364724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).