About 4-ethyl-6-N-methyl-1,4-dihydropyrimidine-5,6-diamine
4-ethyl-6-N-methyl-1,4-dihydropyrimidine-5,6-diamine (PubChem CID 163453185) has the molecular formula C7H14N4
and a molecular weight of 154.22 g/mol. Its IUPAC name is 4-ethyl-6-N-methyl-1,4-dihydropyrimidine-5,6-diamine.
Analyze 4-ethyl-6-N-methyl-1,4-dihydropyrimidine-5,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-6-N-methyl-1,4-dihydropyrimidine-5,6-diamine?
The IUPAC name of 4-ethyl-6-N-methyl-1,4-dihydropyrimidine-5,6-diamine (CID 163453185) is 4-ethyl-6-N-methyl-1,4-dihydropyrimidine-5,6-diamine.
What is the SMILES notation for 4-ethyl-6-N-methyl-1,4-dihydropyrimidine-5,6-diamine?
The canonical SMILES for 4-ethyl-6-N-methyl-1,4-dihydropyrimidine-5,6-diamine is CCC1N=CNC(NC)=C1N.
What is the InChIKey of 4-ethyl-6-N-methyl-1,4-dihydropyrimidine-5,6-diamine?
The InChIKey is BIFVMXQUCTVBEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4/c1-3-5-6(8)7(9-2)11-4-10-5/h4-5,9H,3,8H2,1-2H3,(H,10,11).
What are the key properties of 4-ethyl-6-N-methyl-1,4-dihydropyrimidine-5,6-diamine?
4-ethyl-6-N-methyl-1,4-dihydropyrimidine-5,6-diamine has a molecular weight of 154.22 g/mol, XLogP of -0.26, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-6-N-methyl-1,4-dihydropyrimidine-5,6-diamine is sourced from PubChem (CID 163453185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).