C6H10N4 — CID 171816845
6-methyl-6,7,8,9-tetrahydro-3H-purine (PubChem CID 171816845) has the molecular formula C6H10N4 and a molecular weight of 138.17 g/mol. Its IUPAC name is 6-methyl-6,7,8,9-tetrahydro-3H-purine.
| Compound Name | 6-methyl-6,7,8,9-tetrahydro-3H-purine |
|---|---|
| PubChem CID | 171816845 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 6-methyl-6,7,8,9-tetrahydro-3H-purine |
| SMILES | CC1N=CNC2=C1NCN2 |
| InChI | InChI=1S/C6H10N4/c1-4-5-6(9-2-7-4)10-3-8-5/h2,4,8,10H,3H2,1H3,(H,7,9) |
| InChIKey | DESJIRIGIQZZDU-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |