C27H36N4O3 — CID 143366761
N-[6-benzyl-1-[2-[[(3Z)-3-ethenylhexa-3,5-dienyl]amino]-2-oxoethyl]-2-oxo-3-pyridinyl]butanamide;methanamine (PubChem CID 143366761) has the molecular formula C27H36N4O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is N-[6-benzyl-1-[2-[[(3Z)-3-ethenylhexa-3,5-dienyl]amino]-2-oxoethyl]-2-oxo-3-pyridinyl]butanamide;methanamine.
| Compound Name | N-[6-benzyl-1-[2-[[(3Z)-3-ethenylhexa-3,5-dienyl]amino]-2-oxoethyl]-2-oxo-3-pyridinyl]butanamide;methanamine |
|---|---|
| PubChem CID | 143366761 |
| Molecular Formula | C27H36N4O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | N-[6-benzyl-1-[2-[[(3Z)-3-ethenylhexa-3,5-dienyl]amino]-2-oxoethyl]-2-oxo-3-pyridinyl]butanamide;methanamine |
| SMILES | C=C/C=C(\C=C)CCNC(=O)Cn1c(Cc2ccccc2)ccc(NC(=O)CCC)c1=O.CN |
| InChI | InChI=1S/C26H31N3O3.CH5N/c1-4-10-20(6-3)16-17-27-25(31)19-29-22(18-21-12-8-7-9-13-21)14-15-23(26(29)32)28-24(30)11-5-2;1-2/h4,6-10,12-15H,1,3,5,11,16-19H2,2H3,(H,27,31)(H,28,30);2H2,1H3/b20-10+; |
| InChIKey | UGPKDRXKCYEGNS-XZISABOOSA-N |
| XLogP | 3.56 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|