C13H20N2O — CID 165439706
N-[3-(aminomethyl)-2,4-dimethylphenyl]butanamide (PubChem CID 165439706) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is N-[3-(aminomethyl)-2,4-dimethylphenyl]butanamide.
| Compound Name | N-[3-(aminomethyl)-2,4-dimethylphenyl]butanamide |
|---|---|
| PubChem CID | 165439706 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | N-[3-(aminomethyl)-2,4-dimethylphenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(C)c(CN)c1C |
| InChI | InChI=1S/C13H20N2O/c1-4-5-13(16)15-12-7-6-9(2)11(8-14)10(12)3/h6-7H,4-5,8,14H2,1-3H3,(H,15,16) |
| InChIKey | CXAOZPHRDJVGHC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |