C30H42N4O5S — CID 143367480
N-[1-(benzylcarbamoylamino)-3-hydroxybut-3-en-2-yl]-2-(naphthalen-2-ylsulfonylamino)acetamide;propane (PubChem CID 143367480) has the molecular formula C30H42N4O5S and a molecular weight of 570.76 g/mol. Its IUPAC name is N-[1-(benzylcarbamoylamino)-3-hydroxybut-3-en-2-yl]-2-(naphthalen-2-ylsulfonylamino)acetamide;propane.
| Compound Name | N-[1-(benzylcarbamoylamino)-3-hydroxybut-3-en-2-yl]-2-(naphthalen-2-ylsulfonylamino)acetamide;propane |
|---|---|
| PubChem CID | 143367480 |
| Molecular Formula | C30H42N4O5S |
| Molecular Weight | 570.76 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | N-[1-(benzylcarbamoylamino)-3-hydroxybut-3-en-2-yl]-2-(naphthalen-2-ylsulfonylamino)acetamide;propane |
| SMILES | C=C(O)C(CNC(=O)NCc1ccccc1)NC(=O)CNS(=O)(=O)c1ccc2ccccc2c1.CCC.CCC |
| InChI | InChI=1S/C24H26N4O5S.2C3H8/c1-17(29)22(15-26-24(31)25-14-18-7-3-2-4-8-18)28-23(30)16-27-34(32,33)21-12-11-19-9-5-6-10-20(19)13-21;2*1-3-2/h2-13,22,27,29H,1,14-16H2,(H,28,30)(H2,25,26,31);2*3H2,1-2H3 |
| InChIKey | STXNRMJFTGKTDW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.76 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|