C23H27FN4O3 — CID 143369197
N-(2,2-dimethylpropyl)-6-[3-[[(E)-C-ethenyl-N-hydroxycarbonimidoyl]carbamoyl]-6-fluoro-7-methylcyclohepta-1,3,6-trien-1-yl]pyridine-3-carboxamide (PubChem CID 143369197) has the molecular formula C23H27FN4O3 and a molecular weight of 426.49 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-6-[3-[[(E)-C-ethenyl-N-hydroxycarbonimidoyl]carbamoyl]-6-fluoro-7-methylcyclohepta-1,3,6-trien-1-yl]pyridine-3-carboxamide.
| Compound Name | N-(2,2-dimethylpropyl)-6-[3-[[(E)-C-ethenyl-N-hydroxycarbonimidoyl]carbamoyl]-6-fluoro-7-methylcyclohepta-1,3,6-trien-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 143369197 |
| Molecular Formula | C23H27FN4O3 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | N-(2,2-dimethylpropyl)-6-[3-[[(E)-C-ethenyl-N-hydroxycarbonimidoyl]carbamoyl]-6-fluoro-7-methylcyclohepta-1,3,6-trien-1-yl]pyridine-3-carboxamide |
| SMILES | C=C/C(=N\O)NC(=O)C1=CCC(F)=C(C)C(c2ccc(C(=O)NCC(C)(C)C)cn2)=C1 |
| InChI | InChI=1S/C23H27FN4O3/c1-6-20(28-31)27-22(30)15-7-9-18(24)14(2)17(11-15)19-10-8-16(12-25-19)21(29)26-13-23(3,4)5/h6-8,10-12,31H,1,9,13H2,2-5H3,(H,26,29)(H,27,28,30) |
| InChIKey | FJCDDJVQMLKTFH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|