About ethane;2-(ethylamino)ethanol;4-(4-sulfanylphenyl)benzonitrile
ethane;2-(ethylamino)ethanol;4-(4-sulfanylphenyl)benzonitrile (PubChem CID 143369535) has the molecular formula C19H26N2OS
and a molecular weight of 330.50 g/mol. Its IUPAC name is ethane;2-(ethylamino)ethanol;4-(4-sulfanylphenyl)benzonitrile.
Molecular Properties
| Compound Name | ethane;2-(ethylamino)ethanol;4-(4-sulfanylphenyl)benzonitrile |
| PubChem CID | 143369535 |
| Molecular Formula | C19H26N2OS |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | ethane;2-(ethylamino)ethanol;4-(4-sulfanylphenyl)benzonitrile |
| SMILES | CC.CCNCCO.N#Cc1ccc(-c2ccc(S)cc2)cc1 |
| InChI | InChI=1S/C13H9NS.C4H11NO.C2H6/c14-9-10-1-3-11(4-2-10)12-5-7-13(15)8-6-12;1-2-5-3-4-6;1-2/h1-8,15H;5-6H,2-4H2,1H3;1-2H3 |
| InChIKey | GUILFLWTJRXRGD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-(ethylamino)ethanol;4-(4-sulfanylphenyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(ethylamino)ethanol;4-(4-sulfanylphenyl)benzonitrile?
The IUPAC name of ethane;2-(ethylamino)ethanol;4-(4-sulfanylphenyl)benzonitrile (CID 143369535) is ethane;2-(ethylamino)ethanol;4-(4-sulfanylphenyl)benzonitrile.
What is the SMILES notation for ethane;2-(ethylamino)ethanol;4-(4-sulfanylphenyl)benzonitrile?
The canonical SMILES for ethane;2-(ethylamino)ethanol;4-(4-sulfanylphenyl)benzonitrile is CC.CCNCCO.N#Cc1ccc(-c2ccc(S)cc2)cc1.
What is the InChIKey of ethane;2-(ethylamino)ethanol;4-(4-sulfanylphenyl)benzonitrile?
The InChIKey is GUILFLWTJRXRGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NS.C4H11NO.C2H6/c14-9-10-1-3-11(4-2-10)12-5-7-13(15)8-6-12;1-2-5-3-4-6;1-2/h1-8,15H;5-6H,2-4H2,1H3;1-2H3.
What are the key properties of ethane;2-(ethylamino)ethanol;4-(4-sulfanylphenyl)benzonitrile?
ethane;2-(ethylamino)ethanol;4-(4-sulfanylphenyl)benzonitrile has a molecular weight of 330.50 g/mol, XLogP of 4.13, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(ethylamino)ethanol;4-(4-sulfanylphenyl)benzonitrile is sourced from PubChem (CID 143369535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).