About 4-methylsulfanylbenzonitrile;4-sulfanylbenzonitrile
4-methylsulfanylbenzonitrile;4-sulfanylbenzonitrile (PubChem CID 67600321) has the molecular formula C15H12N2S2
and a molecular weight of 284.41 g/mol. Its IUPAC name is 4-methylsulfanylbenzonitrile;4-sulfanylbenzonitrile.
Molecular Properties
| Compound Name | 4-methylsulfanylbenzonitrile;4-sulfanylbenzonitrile |
| PubChem CID | 67600321 |
| Molecular Formula | C15H12N2S2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 4-methylsulfanylbenzonitrile;4-sulfanylbenzonitrile |
| SMILES | CSc1ccc(C#N)cc1.N#Cc1ccc(S)cc1 |
| InChI | InChI=1S/C8H7NS.C7H5NS/c1-10-8-4-2-7(6-9)3-5-8;8-5-6-1-3-7(9)4-2-6/h2-5H,1H3;1-4,9H |
| InChIKey | LJTTXAKHNOBSQA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylsulfanylbenzonitrile;4-sulfanylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfanylbenzonitrile;4-sulfanylbenzonitrile?
The IUPAC name of 4-methylsulfanylbenzonitrile;4-sulfanylbenzonitrile (CID 67600321) is 4-methylsulfanylbenzonitrile;4-sulfanylbenzonitrile.
What is the SMILES notation for 4-methylsulfanylbenzonitrile;4-sulfanylbenzonitrile?
The canonical SMILES for 4-methylsulfanylbenzonitrile;4-sulfanylbenzonitrile is CSc1ccc(C#N)cc1.N#Cc1ccc(S)cc1.
What is the InChIKey of 4-methylsulfanylbenzonitrile;4-sulfanylbenzonitrile?
The InChIKey is LJTTXAKHNOBSQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NS.C7H5NS/c1-10-8-4-2-7(6-9)3-5-8;8-5-6-1-3-7(9)4-2-6/h2-5H,1H3;1-4,9H.
What are the key properties of 4-methylsulfanylbenzonitrile;4-sulfanylbenzonitrile?
4-methylsulfanylbenzonitrile;4-sulfanylbenzonitrile has a molecular weight of 284.41 g/mol, XLogP of 4.13, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfanylbenzonitrile;4-sulfanylbenzonitrile is sourced from PubChem (CID 67600321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).