About 3-sulfanylbenzonitrile;4-sulfanylbenzonitrile
3-sulfanylbenzonitrile;4-sulfanylbenzonitrile (PubChem CID 158749997) has the molecular formula C14H10N2S2
and a molecular weight of 270.38 g/mol. Its IUPAC name is 3-sulfanylbenzonitrile;4-sulfanylbenzonitrile.
Molecular Properties
| Compound Name | 3-sulfanylbenzonitrile;4-sulfanylbenzonitrile |
| PubChem CID | 158749997 |
| Molecular Formula | C14H10N2S2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 3-sulfanylbenzonitrile;4-sulfanylbenzonitrile |
| SMILES | N#Cc1ccc(S)cc1.N#Cc1cccc(S)c1 |
| InChI | InChI=1S/2C7H5NS/c8-5-6-1-3-7(9)4-2-6;8-5-6-2-1-3-7(9)4-6/h2*1-4,9H |
| InChIKey | INIWGIBLXJNJGW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-sulfanylbenzonitrile;4-sulfanylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-sulfanylbenzonitrile;4-sulfanylbenzonitrile?
The IUPAC name of 3-sulfanylbenzonitrile;4-sulfanylbenzonitrile (CID 158749997) is 3-sulfanylbenzonitrile;4-sulfanylbenzonitrile.
What is the SMILES notation for 3-sulfanylbenzonitrile;4-sulfanylbenzonitrile?
The canonical SMILES for 3-sulfanylbenzonitrile;4-sulfanylbenzonitrile is N#Cc1ccc(S)cc1.N#Cc1cccc(S)c1.
What is the InChIKey of 3-sulfanylbenzonitrile;4-sulfanylbenzonitrile?
The InChIKey is INIWGIBLXJNJGW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H5NS/c8-5-6-1-3-7(9)4-2-6;8-5-6-2-1-3-7(9)4-6/h2*1-4,9H.
What are the key properties of 3-sulfanylbenzonitrile;4-sulfanylbenzonitrile?
3-sulfanylbenzonitrile;4-sulfanylbenzonitrile has a molecular weight of 270.38 g/mol, XLogP of 3.69, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-sulfanylbenzonitrile;4-sulfanylbenzonitrile is sourced from PubChem (CID 158749997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).