C10H15F3O3 — CID 143370276
(2S)-2-methyl-3-oxobutanal;(Z)-4,4,4-trifluoro-3-methylbut-2-en-2-ol (PubChem CID 143370276) has the molecular formula C10H15F3O3 and a molecular weight of 240.22 g/mol. Its IUPAC name is (2S)-2-methyl-3-oxobutanal;(Z)-4,4,4-trifluoro-3-methylbut-2-en-2-ol.
| Compound Name | (2S)-2-methyl-3-oxobutanal;(Z)-4,4,4-trifluoro-3-methylbut-2-en-2-ol |
|---|---|
| PubChem CID | 143370276 |
| Molecular Formula | C10H15F3O3 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (2S)-2-methyl-3-oxobutanal;(Z)-4,4,4-trifluoro-3-methylbut-2-en-2-ol |
| SMILES | C/C(O)=C(\C)C(F)(F)F.CC(=O)[C@@H](C)C=O |
| InChI | InChI=1S/C5H7F3O.C5H8O2/c1-3(4(2)9)5(6,7)8;1-4(3-6)5(2)7/h9H,1-2H3;3-4H,1-2H3/b4-3-;/t;4-/m.0/s1 |
| InChIKey | JBVSRBWWKPTYJK-ZFCAMEQTSA-N |
| XLogP | 2.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|