C30H30F3N5O3 — CID 143372125
1-(1-ethylindol-3-yl)-2,2,2-trifluoro-1-[1-(4-methylphenyl)indazol-5-yl]ethanol;2-[formyl(methyl)amino]acetamide (PubChem CID 143372125) has the molecular formula C30H30F3N5O3 and a molecular weight of 565.60 g/mol. Its IUPAC name is 1-(1-ethylindol-3-yl)-2,2,2-trifluoro-1-[1-(4-methylphenyl)indazol-5-yl]ethanol;2-[formyl(methyl)amino]acetamide.
| Compound Name | 1-(1-ethylindol-3-yl)-2,2,2-trifluoro-1-[1-(4-methylphenyl)indazol-5-yl]ethanol;2-[formyl(methyl)amino]acetamide |
|---|---|
| PubChem CID | 143372125 |
| Molecular Formula | C30H30F3N5O3 |
| Molecular Weight | 565.60 g/mol |
| Exact Mass | 565.23 |
| IUPAC Name | 1-(1-ethylindol-3-yl)-2,2,2-trifluoro-1-[1-(4-methylphenyl)indazol-5-yl]ethanol;2-[formyl(methyl)amino]acetamide |
| SMILES | CCn1cc(C(O)(c2ccc3c(cnn3-c3ccc(C)cc3)c2)C(F)(F)F)c2ccccc21.CN(C=O)CC(N)=O |
| InChI | InChI=1S/C26H22F3N3O.C4H8N2O2/c1-3-31-16-22(21-6-4-5-7-24(21)31)25(33,26(27,28)29)19-10-13-23-18(14-19)15-30-32(23)20-11-8-17(2)9-12-20;1-6(3-7)2-4(5)8/h4-16,33H,3H2,1-2H3;3H,2H2,1H3,(H2,5,8) |
| InChIKey | XBUFHXDYTBZOLP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.60 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|