C26H29FN2O2 — CID 143373074
cyclopropylmethanol;1-[(1S)-1-(4-fluorophenyl)-2-quinolin-8-ylethyl]piperidin-2-one (PubChem CID 143373074) has the molecular formula C26H29FN2O2 and a molecular weight of 420.53 g/mol. Its IUPAC name is cyclopropylmethanol;1-[(1S)-1-(4-fluorophenyl)-2-quinolin-8-ylethyl]piperidin-2-one.
| Compound Name | cyclopropylmethanol;1-[(1S)-1-(4-fluorophenyl)-2-quinolin-8-ylethyl]piperidin-2-one |
|---|---|
| PubChem CID | 143373074 |
| Molecular Formula | C26H29FN2O2 |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | cyclopropylmethanol;1-[(1S)-1-(4-fluorophenyl)-2-quinolin-8-ylethyl]piperidin-2-one |
| SMILES | O=C1CCCCN1[C@@H](Cc1cccc2cccnc12)c1ccc(F)cc1.OCC1CC1 |
| InChI | InChI=1S/C22H21FN2O.C4H8O/c23-19-11-9-16(10-12-19)20(25-14-2-1-8-21(25)26)15-18-6-3-5-17-7-4-13-24-22(17)18;5-3-4-1-2-4/h3-7,9-13,20H,1-2,8,14-15H2;4-5H,1-3H2/t20-;/m0./s1 |
| InChIKey | VAUBPKUMKFZUPV-BDQAORGHSA-N |
| XLogP | 5.06 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |