C25H26FN3O — CID 110136746
(3aR,8aR)-4-[(4-fluorophenyl)methyl]-1-(quinolin-8-ylmethyl)-3,3a,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-5-one (PubChem CID 110136746) has the molecular formula C25H26FN3O and a molecular weight of 403.50 g/mol. Its IUPAC name is (3aR,8aR)-4-[(4-fluorophenyl)methyl]-1-(quinolin-8-ylmethyl)-3,3a,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-5-one.
| Compound Name | (3aR,8aR)-4-[(4-fluorophenyl)methyl]-1-(quinolin-8-ylmethyl)-3,3a,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-5-one |
|---|---|
| PubChem CID | 110136746 |
| Molecular Formula | C25H26FN3O |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (3aR,8aR)-4-[(4-fluorophenyl)methyl]-1-(quinolin-8-ylmethyl)-3,3a,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-5-one |
| SMILES | O=C1CCC[C@@H]2[C@@H](CCN2Cc2cccc3cccnc23)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C25H26FN3O/c26-21-11-9-18(10-12-21)16-29-23-13-15-28(22(23)7-2-8-24(29)30)17-20-5-1-4-19-6-3-14-27-25(19)20/h1,3-6,9-12,14,22-23H,2,7-8,13,15-17H2/t22-,23-/m1/s1 |
| InChIKey | BINLLWGAIQKFEZ-DHIUTWEWSA-N |
| XLogP | 4.53 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |