C18H18F4N4O — CID 131685521
(3aS,6aS)-4-[(4-fluorophenyl)methyl]-1-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one (PubChem CID 131685521) has the molecular formula C18H18F4N4O and a molecular weight of 382.36 g/mol. Its IUPAC name is (3aS,6aS)-4-[(4-fluorophenyl)methyl]-1-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one.
| Compound Name | (3aS,6aS)-4-[(4-fluorophenyl)methyl]-1-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
|---|---|
| PubChem CID | 131685521 |
| Molecular Formula | C18H18F4N4O |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | (3aS,6aS)-4-[(4-fluorophenyl)methyl]-1-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
| SMILES | O=C1C[C@H]2[C@H](CCN2Cc2ncc(C(F)(F)F)[nH]2)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H18F4N4O/c19-12-3-1-11(2-4-12)9-26-13-5-6-25(14(13)7-17(26)27)10-16-23-8-15(24-16)18(20,21)22/h1-4,8,13-14H,5-7,9-10H2,(H,23,24)/t13-,14-/m0/s1 |
| InChIKey | PPRMMSBWAUOGSM-KBPBESRZSA-N |
| XLogP | 2.94 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |