C21H19Cl2F3N2O — CID 131685485
(3aS,6aS)-4-[(2,6-dichlorophenyl)methyl]-1-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one (PubChem CID 131685485) has the molecular formula C21H19Cl2F3N2O and a molecular weight of 443.30 g/mol. Its IUPAC name is (3aS,6aS)-4-[(2,6-dichlorophenyl)methyl]-1-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one.
| Compound Name | (3aS,6aS)-4-[(2,6-dichlorophenyl)methyl]-1-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
|---|---|
| PubChem CID | 131685485 |
| Molecular Formula | C21H19Cl2F3N2O |
| Molecular Weight | 443.30 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | (3aS,6aS)-4-[(2,6-dichlorophenyl)methyl]-1-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
| SMILES | O=C1C[C@H]2[C@H](CCN2Cc2cccc(C(F)(F)F)c2)N1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H19Cl2F3N2O/c22-16-5-2-6-17(23)15(16)12-28-18-7-8-27(19(18)10-20(28)29)11-13-3-1-4-14(9-13)21(24,25)26/h1-6,9,18-19H,7-8,10-12H2/t18-,19-/m0/s1 |
| InChIKey | WMQZCAVXCPPNPW-OALUTQOASA-N |
| XLogP | 5.39 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.30 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |