C22H23F3N2O — CID 131685699
(3aS,6aS)-4-(1-phenylethyl)-1-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one (PubChem CID 131685699) has the molecular formula C22H23F3N2O and a molecular weight of 388.43 g/mol. Its IUPAC name is (3aS,6aS)-4-(1-phenylethyl)-1-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one.
| Compound Name | (3aS,6aS)-4-(1-phenylethyl)-1-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
|---|---|
| PubChem CID | 131685699 |
| Molecular Formula | C22H23F3N2O |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (3aS,6aS)-4-(1-phenylethyl)-1-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
| SMILES | CC(c1ccccc1)N1C(=O)C[C@H]2[C@@H]1CCN2Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H23F3N2O/c1-15(17-7-3-2-4-8-17)27-19-10-11-26(20(19)13-21(27)28)14-16-6-5-9-18(12-16)22(23,24)25/h2-9,12,15,19-20H,10-11,13-14H2,1H3/t15?,19-,20-/m0/s1 |
| InChIKey | XFLYUJVDRLTUJC-FIRGRZAASA-N |
| XLogP | 4.64 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |