C20H23F3N4O — CID 131685516
(3aS,6aS)-4-[(2,5-dimethylpyrazol-3-yl)methyl]-1-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one (PubChem CID 131685516) has the molecular formula C20H23F3N4O and a molecular weight of 392.43 g/mol. Its IUPAC name is (3aS,6aS)-4-[(2,5-dimethylpyrazol-3-yl)methyl]-1-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one.
| Compound Name | (3aS,6aS)-4-[(2,5-dimethylpyrazol-3-yl)methyl]-1-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
|---|---|
| PubChem CID | 131685516 |
| Molecular Formula | C20H23F3N4O |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (3aS,6aS)-4-[(2,5-dimethylpyrazol-3-yl)methyl]-1-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
| SMILES | Cc1cc(CN2C(=O)C[C@H]3[C@@H]2CCN3Cc2cccc(C(F)(F)F)c2)n(C)n1 |
| InChI | InChI=1S/C20H23F3N4O/c1-13-8-16(25(2)24-13)12-27-17-6-7-26(18(17)10-19(27)28)11-14-4-3-5-15(9-14)20(21,22)23/h3-5,8-9,17-18H,6-7,10-12H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | YRXIBMVJGSBLDQ-ROUUACIJSA-N |
| XLogP | 3.12 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |