C14H23NO4 — CID 14337385
ethyl 7,7-diethoxy-2-azabicyclo[2.2.2]oct-5-ene-2-carboxylate (PubChem CID 14337385) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is ethyl 7,7-diethoxy-2-azabicyclo[2.2.2]oct-5-ene-2-carboxylate.
| Compound Name | ethyl 7,7-diethoxy-2-azabicyclo[2.2.2]oct-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 14337385 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | ethyl 7,7-diethoxy-2-azabicyclo[2.2.2]oct-5-ene-2-carboxylate |
| SMILES | CCOC(=O)N1CC2C=CC1C(OCC)(OCC)C2 |
| InChI | InChI=1S/C14H23NO4/c1-4-17-13(16)15-10-11-7-8-12(15)14(9-11,18-5-2)19-6-3/h7-8,11-12H,4-6,9-10H2,1-3H3 |
| InChIKey | RSALWTZXOVQJSG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|