C16H19NO3 — CID 101019374
ethyl (1R,2R)-12-oxa-3-azatetracyclo[4.4.3.22,5.01,6]pentadeca-7,9,14-triene-3-carboxylate (PubChem CID 101019374) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is ethyl (1R,2R)-12-oxa-3-azatetracyclo[4.4.3.22,5.01,6]pentadeca-7,9,14-triene-3-carboxylate.
| Compound Name | ethyl (1R,2R)-12-oxa-3-azatetracyclo[4.4.3.22,5.01,6]pentadeca-7,9,14-triene-3-carboxylate |
|---|---|
| PubChem CID | 101019374 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | ethyl (1R,2R)-12-oxa-3-azatetracyclo[4.4.3.22,5.01,6]pentadeca-7,9,14-triene-3-carboxylate |
| SMILES | CCOC(=O)N1CC2C=C[C@@H]1[C@@]13C=CC=CC21COC3 |
| InChI | InChI=1S/C16H19NO3/c1-2-20-14(18)17-9-12-5-6-13(17)16-8-4-3-7-15(12,16)10-19-11-16/h3-8,12-13H,2,9-11H2,1H3/t12?,13-,15?,16+/m1/s1 |
| InChIKey | QNKDCRRSANHPKS-FYAIKVRKSA-N |
| XLogP | 2.14 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|