C14H15NO2 — CID 143375645
7-cyclopropyloxy-1,4-dimethylquinolin-2-one (PubChem CID 143375645) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 7-cyclopropyloxy-1,4-dimethylquinolin-2-one.
| Compound Name | 7-cyclopropyloxy-1,4-dimethylquinolin-2-one |
|---|---|
| PubChem CID | 143375645 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 7-cyclopropyloxy-1,4-dimethylquinolin-2-one |
| SMILES | Cc1cc(=O)n(C)c2cc(OC3CC3)ccc12 |
| InChI | InChI=1S/C14H15NO2/c1-9-7-14(16)15(2)13-8-11(5-6-12(9)13)17-10-3-4-10/h5-8,10H,3-4H2,1-2H3 |
| InChIKey | CGNMNOSDWCEFAJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |