C29H41FN4OS — CID 143376372
N-cyclopropyl-4-[4-(2-fluorophenyl)-2-heptan-4-yl-1,3-thiazol-5-yl]pyrimidin-2-amine;ethane;ethenoxyethane (PubChem CID 143376372) has the molecular formula C29H41FN4OS and a molecular weight of 512.74 g/mol. Its IUPAC name is N-cyclopropyl-4-[4-(2-fluorophenyl)-2-heptan-4-yl-1,3-thiazol-5-yl]pyrimidin-2-amine;ethane;ethenoxyethane.
| Compound Name | N-cyclopropyl-4-[4-(2-fluorophenyl)-2-heptan-4-yl-1,3-thiazol-5-yl]pyrimidin-2-amine;ethane;ethenoxyethane |
|---|---|
| PubChem CID | 143376372 |
| Molecular Formula | C29H41FN4OS |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | N-cyclopropyl-4-[4-(2-fluorophenyl)-2-heptan-4-yl-1,3-thiazol-5-yl]pyrimidin-2-amine;ethane;ethenoxyethane |
| SMILES | C=COCC.CC.CCCC(CCC)c1nc(-c2ccccc2F)c(-c2ccnc(NC3CC3)n2)s1 |
| InChI | InChI=1S/C23H27FN4S.C4H8O.C2H6/c1-3-7-15(8-4-2)22-28-20(17-9-5-6-10-18(17)24)21(29-22)19-13-14-25-23(27-19)26-16-11-12-16;1-3-5-4-2;1-2/h5-6,9-10,13-16H,3-4,7-8,11-12H2,1-2H3,(H,25,26,27);3H,1,4H2,2H3;1-2H3 |
| InChIKey | FMVRAQVOKNOQDP-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|