C22H32F2NO3P — CID 143379483
2-[4-[cyclopropyl-[4-(1-fluoro-1-phosphanylpropan-2-yl)benzoyl]amino]cyclohexyl]acetic acid;fluoromethane (PubChem CID 143379483) has the molecular formula C22H32F2NO3P and a molecular weight of 427.47 g/mol. Its IUPAC name is 2-[4-[cyclopropyl-[4-(1-fluoro-1-phosphanylpropan-2-yl)benzoyl]amino]cyclohexyl]acetic acid;fluoromethane.
| Compound Name | 2-[4-[cyclopropyl-[4-(1-fluoro-1-phosphanylpropan-2-yl)benzoyl]amino]cyclohexyl]acetic acid;fluoromethane |
|---|---|
| PubChem CID | 143379483 |
| Molecular Formula | C22H32F2NO3P |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 2-[4-[cyclopropyl-[4-(1-fluoro-1-phosphanylpropan-2-yl)benzoyl]amino]cyclohexyl]acetic acid;fluoromethane |
| SMILES | CC(c1ccc(C(=O)N(C2CCC(CC(=O)O)CC2)C2CC2)cc1)C(F)P.CF |
| InChI | InChI=1S/C21H29FNO3P.CH3F/c1-13(20(22)27)15-4-6-16(7-5-15)21(26)23(18-10-11-18)17-8-2-14(3-9-17)12-19(24)25;1-2/h4-7,13-14,17-18,20H,2-3,8-12,27H2,1H3,(H,24,25);1H3 |
| InChIKey | ZAKWCFHYOIAAIJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|