C9H11NS — CID 143381742
5-ethenyl-4-[(Z)-prop-1-enyl]-6H-1,3-thiazine (PubChem CID 143381742) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 5-ethenyl-4-[(Z)-prop-1-enyl]-6H-1,3-thiazine.
| Compound Name | 5-ethenyl-4-[(Z)-prop-1-enyl]-6H-1,3-thiazine |
|---|---|
| PubChem CID | 143381742 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 5-ethenyl-4-[(Z)-prop-1-enyl]-6H-1,3-thiazine |
| SMILES | C=CC1=C(/C=C\C)N=CSC1 |
| InChI | InChI=1S/C9H11NS/c1-3-5-9-8(4-2)6-11-7-10-9/h3-5,7H,2,6H2,1H3/b5-3- |
| InChIKey | DBTQDKQSORRZBW-HYXAFXHYSA-N |
| XLogP | 2.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |