C22H27N3O4 — CID 143381944
4-[[4-[2-(aminomethylideneamino)-3-ethenylphenoxy]benzoyl]amino]butanoic acid;ethane (PubChem CID 143381944) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 4-[[4-[2-(aminomethylideneamino)-3-ethenylphenoxy]benzoyl]amino]butanoic acid;ethane.
| Compound Name | 4-[[4-[2-(aminomethylideneamino)-3-ethenylphenoxy]benzoyl]amino]butanoic acid;ethane |
|---|---|
| PubChem CID | 143381944 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 4-[[4-[2-(aminomethylideneamino)-3-ethenylphenoxy]benzoyl]amino]butanoic acid;ethane |
| SMILES | C=Cc1cccc(Oc2ccc(C(=O)NCCCC(=O)O)cc2)c1/N=C/N.CC |
| InChI | InChI=1S/C20H21N3O4.C2H6/c1-2-14-5-3-6-17(19(14)23-13-21)27-16-10-8-15(9-11-16)20(26)22-12-4-7-18(24)25;1-2/h2-3,5-6,8-11,13H,1,4,7,12H2,(H2,21,23)(H,22,26)(H,24,25);1-2H3 |
| InChIKey | DJIWFEDBAVHLOL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|