C17H16F2N2O3 — CID 56788122
N-(4-amino-4-oxobutyl)-4-(2,4-difluorophenoxy)benzamide (PubChem CID 56788122) has the molecular formula C17H16F2N2O3 and a molecular weight of 334.32 g/mol. Its IUPAC name is N-(4-amino-4-oxobutyl)-4-(2,4-difluorophenoxy)benzamide.
| Compound Name | N-(4-amino-4-oxobutyl)-4-(2,4-difluorophenoxy)benzamide |
|---|---|
| PubChem CID | 56788122 |
| Molecular Formula | C17H16F2N2O3 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-(4-amino-4-oxobutyl)-4-(2,4-difluorophenoxy)benzamide |
| SMILES | NC(=O)CCCNC(=O)c1ccc(Oc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C17H16F2N2O3/c18-12-5-8-15(14(19)10-12)24-13-6-3-11(4-7-13)17(23)21-9-1-2-16(20)22/h3-8,10H,1-2,9H2,(H2,20,22)(H,21,23) |
| InChIKey | MRCJGKMDJFGYGH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|