C14H13NOS — CID 143382317
2-(naphthalen-1-ylmethyl)-1,2-thiazolidin-3-one (PubChem CID 143382317) has the molecular formula C14H13NOS and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-(naphthalen-1-ylmethyl)-1,2-thiazolidin-3-one.
| Compound Name | 2-(naphthalen-1-ylmethyl)-1,2-thiazolidin-3-one |
|---|---|
| PubChem CID | 143382317 |
| Molecular Formula | C14H13NOS |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-(naphthalen-1-ylmethyl)-1,2-thiazolidin-3-one |
| SMILES | O=C1CCSN1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C14H13NOS/c16-14-8-9-17-15(14)10-12-6-3-5-11-4-1-2-7-13(11)12/h1-7H,8-10H2 |
| InChIKey | YZMPVCUCKJVJAH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|