C27H38BrN5O3S — CID 143382531
(2Z,4E)-3-[1-[1-[(2-amino-4-pyridinyl)methyl]piperidine-4-carbonyl]piperidin-4-yl]oxy-4-bromo-5-methylsulfanyl-1-pyrrolidin-1-ylpenta-2,4-dien-1-one (PubChem CID 143382531) has the molecular formula C27H38BrN5O3S and a molecular weight of 592.60 g/mol. Its IUPAC name is (2Z,4E)-3-[1-[1-[(2-amino-4-pyridinyl)methyl]piperidine-4-carbonyl]piperidin-4-yl]oxy-4-bromo-5-methylsulfanyl-1-pyrrolidin-1-ylpenta-2,4-dien-1-one.
| Compound Name | (2Z,4E)-3-[1-[1-[(2-amino-4-pyridinyl)methyl]piperidine-4-carbonyl]piperidin-4-yl]oxy-4-bromo-5-methylsulfanyl-1-pyrrolidin-1-ylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 143382531 |
| Molecular Formula | C27H38BrN5O3S |
| Molecular Weight | 592.60 g/mol |
| Exact Mass | 591.19 |
| IUPAC Name | (2Z,4E)-3-[1-[1-[(2-amino-4-pyridinyl)methyl]piperidine-4-carbonyl]piperidin-4-yl]oxy-4-bromo-5-methylsulfanyl-1-pyrrolidin-1-ylpenta-2,4-dien-1-one |
| SMILES | CS/C=C(Br)\C(=C\C(=O)N1CCCC1)OC1CCN(C(=O)C2CCN(Cc3ccnc(N)c3)CC2)CC1 |
| InChI | InChI=1S/C27H38BrN5O3S/c1-37-19-23(28)24(17-26(34)32-10-2-3-11-32)36-22-7-14-33(15-8-22)27(35)21-5-12-31(13-6-21)18-20-4-9-30-25(29)16-20/h4,9,16-17,19,21-22H,2-3,5-8,10-15,18H2,1H3,(H2,29,30)/b23-19+,24-17- |
| InChIKey | WBZHSJKROWZPRM-SOSXSPFWSA-N |
| XLogP | 3.99 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.60 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|