C26H24F6N2O2S2 — CID 143382883
(E)-4,4,4-trifluoro-N-[3-hydroxy-1-phenyl-4-[thiophen-2-ylmethyl-(2,4,5-trifluorophenyl)sulfanylamino]butan-2-yl]-3-methylbut-2-enamide (PubChem CID 143382883) has the molecular formula C26H24F6N2O2S2 and a molecular weight of 574.61 g/mol. Its IUPAC name is (E)-4,4,4-trifluoro-N-[3-hydroxy-1-phenyl-4-[thiophen-2-ylmethyl-(2,4,5-trifluorophenyl)sulfanylamino]butan-2-yl]-3-methylbut-2-enamide.
| Compound Name | (E)-4,4,4-trifluoro-N-[3-hydroxy-1-phenyl-4-[thiophen-2-ylmethyl-(2,4,5-trifluorophenyl)sulfanylamino]butan-2-yl]-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 143382883 |
| Molecular Formula | C26H24F6N2O2S2 |
| Molecular Weight | 574.61 g/mol |
| Exact Mass | 574.12 |
| IUPAC Name | (E)-4,4,4-trifluoro-N-[3-hydroxy-1-phenyl-4-[thiophen-2-ylmethyl-(2,4,5-trifluorophenyl)sulfanylamino]butan-2-yl]-3-methylbut-2-enamide |
| SMILES | C/C(=C\C(=O)NC(Cc1ccccc1)C(O)CN(Cc1cccs1)Sc1cc(F)c(F)cc1F)C(F)(F)F |
| InChI | InChI=1S/C26H24F6N2O2S2/c1-16(26(30,31)32)10-25(36)33-22(11-17-6-3-2-4-7-17)23(35)15-34(14-18-8-5-9-37-18)38-24-13-20(28)19(27)12-21(24)29/h2-10,12-13,22-23,35H,11,14-15H2,1H3,(H,33,36)/b16-10+ |
| InChIKey | FULISONFLANBDQ-MHWRWJLKSA-N |
| XLogP | 6.27 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.61 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|