C24H25F3N2O4S2 — CID 70317472
N-[3-hydroxy-1-phenyl-4-[thiophen-2-ylmethyl-(2,4,5-trifluorophenyl)sulfonylamino]butan-2-yl]propanamide (PubChem CID 70317472) has the molecular formula C24H25F3N2O4S2 and a molecular weight of 526.60 g/mol. Its IUPAC name is N-[3-hydroxy-1-phenyl-4-[thiophen-2-ylmethyl-(2,4,5-trifluorophenyl)sulfonylamino]butan-2-yl]propanamide.
| Compound Name | N-[3-hydroxy-1-phenyl-4-[thiophen-2-ylmethyl-(2,4,5-trifluorophenyl)sulfonylamino]butan-2-yl]propanamide |
|---|---|
| PubChem CID | 70317472 |
| Molecular Formula | C24H25F3N2O4S2 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | N-[3-hydroxy-1-phenyl-4-[thiophen-2-ylmethyl-(2,4,5-trifluorophenyl)sulfonylamino]butan-2-yl]propanamide |
| SMILES | CCC(=O)NC(Cc1ccccc1)C(O)CN(Cc1cccs1)S(=O)(=O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C24H25F3N2O4S2/c1-2-24(31)28-21(11-16-7-4-3-5-8-16)22(30)15-29(14-17-9-6-10-34-17)35(32,33)23-13-19(26)18(25)12-20(23)27/h3-10,12-13,21-22,30H,2,11,14-15H2,1H3,(H,28,31) |
| InChIKey | KUXGSTLLSDQUFQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|