About acetylene;ethane;(Z)-3-ethenoxyhex-3-ene
acetylene;ethane;(Z)-3-ethenoxyhex-3-ene (PubChem CID 143386947) has the molecular formula C12H22O
and a molecular weight of 182.31 g/mol. Its IUPAC name is acetylene;ethane;(Z)-3-ethenoxyhex-3-ene.
Molecular Properties
| Compound Name | acetylene;ethane;(Z)-3-ethenoxyhex-3-ene |
| PubChem CID | 143386947 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | acetylene;ethane;(Z)-3-ethenoxyhex-3-ene |
| SMILES | C#C.C=CO/C(=C\CC)CC.CC |
| InChI | InChI=1S/C8H14O.C2H6.C2H2/c1-4-7-8(5-2)9-6-3;2*1-2/h6-7H,3-5H2,1-2H3;1-2H3;1-2H/b8-7-;; |
| InChIKey | YRZDUJIZQSAQQP-OTMFCZTRSA-N |
| XLogP | 4.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;ethane;(Z)-3-ethenoxyhex-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;ethane;(Z)-3-ethenoxyhex-3-ene?
The IUPAC name of acetylene;ethane;(Z)-3-ethenoxyhex-3-ene (CID 143386947) is acetylene;ethane;(Z)-3-ethenoxyhex-3-ene.
What is the SMILES notation for acetylene;ethane;(Z)-3-ethenoxyhex-3-ene?
The canonical SMILES for acetylene;ethane;(Z)-3-ethenoxyhex-3-ene is C#C.C=CO/C(=C\CC)CC.CC.
What is the InChIKey of acetylene;ethane;(Z)-3-ethenoxyhex-3-ene?
The InChIKey is YRZDUJIZQSAQQP-OTMFCZTRSA-N. The full InChI is InChI=1S/C8H14O.C2H6.C2H2/c1-4-7-8(5-2)9-6-3;2*1-2/h6-7H,3-5H2,1-2H3;1-2H3;1-2H/b8-7-;;.
What are the key properties of acetylene;ethane;(Z)-3-ethenoxyhex-3-ene?
acetylene;ethane;(Z)-3-ethenoxyhex-3-ene has a molecular weight of 182.31 g/mol, XLogP of 4.13, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;ethane;(Z)-3-ethenoxyhex-3-ene is sourced from PubChem (CID 143386947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).