C34H32N2O2 — CID 143387465
3,6-ditert-butyl-1,4-dinaphthalen-1-ylpyrrolo[3,2-b]pyrrole-2,5-dione (PubChem CID 143387465) has the molecular formula C34H32N2O2 and a molecular weight of 500.64 g/mol. Its IUPAC name is 3,6-ditert-butyl-1,4-dinaphthalen-1-ylpyrrolo[3,2-b]pyrrole-2,5-dione.
| Compound Name | 3,6-ditert-butyl-1,4-dinaphthalen-1-ylpyrrolo[3,2-b]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 143387465 |
| Molecular Formula | C34H32N2O2 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | 3,6-ditert-butyl-1,4-dinaphthalen-1-ylpyrrolo[3,2-b]pyrrole-2,5-dione |
| SMILES | CC(C)(C)C1=C2C(=C(C(C)(C)C)C(=O)N2c2cccc3ccccc23)N(c2cccc3ccccc23)C1=O |
| InChI | InChI=1S/C34H32N2O2/c1-33(2,3)27-29-30(36(31(27)37)26-20-12-16-22-14-8-10-18-24(22)26)28(34(4,5)6)32(38)35(29)25-19-11-15-21-13-7-9-17-23(21)25/h7-20H,1-6H3 |
| InChIKey | KNIQGNUYHUKPKK-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |