C25H31IN7O2- — CID 143387560
CID 143387560 (PubChem CID 143387560) has the molecular formula C25H31IN7O2- and a molecular weight of 588.47 g/mol.
| Compound Name | CID 143387560 |
|---|---|
| PubChem CID | 143387560 |
| Molecular Formula | C25H31IN7O2- |
| Molecular Weight | 588.47 g/mol |
| Exact Mass | 588.16 |
| IUPAC Name | — |
| SMILES | NCCCc1cncc(C2=C[I-]C=NC(Nc3cccc(CN4CCN(CC(=O)O)CC4)c3)=N2)c1 |
| InChI | InChI=1S/C25H31IN7O2/c27-6-2-4-19-11-21(15-28-14-19)23-13-26-18-29-25(31-23)30-22-5-1-3-20(12-22)16-32-7-9-33(10-8-32)17-24(34)35/h1,3,5,11-15,18H,2,4,6-10,16-17,27H2,(H,30,31)(H,34,35)/q-1 |
| InChIKey | MNYCVIBXTCRUGU-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.47 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|