C20H22Cl2N2O3 — CID 143387963
1-[4-[[2-(2,4-dichlorophenoxy)anilino]-hydroxymethyl]piperidin-1-yl]ethanone (PubChem CID 143387963) has the molecular formula C20H22Cl2N2O3 and a molecular weight of 409.31 g/mol. Its IUPAC name is 1-[4-[[2-(2,4-dichlorophenoxy)anilino]-hydroxymethyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[[2-(2,4-dichlorophenoxy)anilino]-hydroxymethyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 143387963 |
| Molecular Formula | C20H22Cl2N2O3 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 1-[4-[[2-(2,4-dichlorophenoxy)anilino]-hydroxymethyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(C(O)Nc2ccccc2Oc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C20H22Cl2N2O3/c1-13(25)24-10-8-14(9-11-24)20(26)23-17-4-2-3-5-19(17)27-18-7-6-15(21)12-16(18)22/h2-7,12,14,20,23,26H,8-11H2,1H3 |
| InChIKey | FDWYIAGCGUKGRN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|