C27H44N2O — CID 143388200
3,3-dimethylbut-1-ene;[4-[4-(1-methylpiperidin-4-yl)butyl]phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 143388200) has the molecular formula C27H44N2O and a molecular weight of 412.66 g/mol. Its IUPAC name is 3,3-dimethylbut-1-ene;[4-[4-(1-methylpiperidin-4-yl)butyl]phenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | 3,3-dimethylbut-1-ene;[4-[4-(1-methylpiperidin-4-yl)butyl]phenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 143388200 |
| Molecular Formula | C27H44N2O |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.35 |
| IUPAC Name | 3,3-dimethylbut-1-ene;[4-[4-(1-methylpiperidin-4-yl)butyl]phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | C=CC(C)(C)C.CN1CCC(CCCCc2ccc(C(=O)N3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C21H32N2O.C6H12/c1-22-16-12-19(13-17-22)7-3-2-6-18-8-10-20(11-9-18)21(24)23-14-4-5-15-23;1-5-6(2,3)4/h8-11,19H,2-7,12-17H2,1H3;5H,1H2,2-4H3 |
| InChIKey | XRGXDJVUHGNVHV-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|