C18H29NO3 — CID 143388468
5-[(E)-2,4-dimethylhex-3-en-2-yl]-2,3,4-trimethoxy-6-methylaniline (PubChem CID 143388468) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is 5-[(E)-2,4-dimethylhex-3-en-2-yl]-2,3,4-trimethoxy-6-methylaniline.
| Compound Name | 5-[(E)-2,4-dimethylhex-3-en-2-yl]-2,3,4-trimethoxy-6-methylaniline |
|---|---|
| PubChem CID | 143388468 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 5-[(E)-2,4-dimethylhex-3-en-2-yl]-2,3,4-trimethoxy-6-methylaniline |
| SMILES | CC/C(C)=C/C(C)(C)c1c(C)c(N)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C18H29NO3/c1-9-11(2)10-18(4,5)13-12(3)14(19)16(21-7)17(22-8)15(13)20-6/h10H,9,19H2,1-8H3/b11-10+ |
| InChIKey | ZBMMLAGKGRKTNJ-ZHACJKMWSA-N |
| XLogP | 4.24 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|