C11H18FNO3 — CID 143391258
tert-butyl (3aR,6R)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate (PubChem CID 143391258) has the molecular formula C11H18FNO3 and a molecular weight of 231.27 g/mol. Its IUPAC name is tert-butyl (3aR,6R)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl (3aR,6R)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 143391258 |
| Molecular Formula | C11H18FNO3 |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | tert-butyl (3aR,6R)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](F)C2OCC[C@H]21 |
| InChI | InChI=1S/C11H18FNO3/c1-11(2,3)16-10(14)13-6-7(12)9-8(13)4-5-15-9/h7-9H,4-6H2,1-3H3/t7-,8-,9?/m1/s1 |
| InChIKey | QZMCLDBOPOVTDS-ZAZKALAHSA-N |
| XLogP | 1.73 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |